| Identification | |
| Name: | 2-Ethylbenzaldehyde |
| Synonyms: | Benzaldehyde,o-ethyl- (6CI,7CI,8CI);o-Ethylbenzaldehyde; |
| CAS: | 22927-13-5 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-2-8-5-3-4-6-9(8)7-10/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 78.4°C |
| Boiling Point: | 205.5°Cat760mmHg |
| Density: | 0.921g/cm3 |
| Refractive index: | 1.538 |
| Specification: |
The cas register number of 2-Ethylbenzaldehyde is 22927-13-5. It also can be called as 2-Ethyl benzaldehyde and the Systematic name about this chemical is Benzaldehyde, 2-ethyl-. Physical properties about 2-Ethylbenzaldehyde are: (1)ACD/LogP: 2.63; (2)ACD/LogD (pH 5.5): 2.63; (3)ACD/LogD (pH 7.4): 2.63 ; (4)#H bond acceptors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 17.07Å2; (7)Index of Refraction: 1.548; (8)Molar Refractivity: 42.55 cm3; (9)Molar Volume: 133.9 cm3; (10)Surface Tension: 36.3 dyne/cm; (11)Density: 1.001 g/cm3; (12)Flash Point: 84.8 °C; (13)Enthalpy of Vaporization: 44.59 kJ/mol; (14)Boiling Point: 209.7 °C at 760 mmHg; (15)Vapour Pressure: 0.2 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Flash Point: | 78.4°C |
| Safety Data | |
 |
|
