| Identification |
| Name: | Benzo[c]cinnoline |
| Synonyms: | 2,2'-Azobiphenyl;3,4-Benzocinnoline;5,6-Diazaphenanthrene;5,6-Phenanthroline;9,10-Diazaphenanthrene;Diphenylenazone;NSC 86935;Phenazone(three-ring system); |
| CAS: | 230-17-1 |
| EINECS: | 205-936-5 |
| Molecular Formula: | C12H8N2 |
| Molecular Weight: | 180.20 |
| InChI: | InChI=1/C12H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13-11/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 170.2°C |
| Boiling Point: | 361.2°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.74 |
| Solubility: | easily soluble in methanol and chloroform, soluble in ethanol, ether and benzene, slightly soluble in water and petroleum ether |
| Appearance: | yellow-green crystalline powder |
| Flash Point: | 170.2°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
