| Identification | |
| Name: | 3-Pyridinol,2-bromo-6-methyl- |
| Synonyms: | 2-Bromo-3-hydroxy-6-methylpyridine;2-Bromo-6-methylpyridin-3-ol; |
| CAS: | 23003-35-2 |
| Molecular Formula: | C6H6BrNO |
| Molecular Weight: | 188.02 |
| InChI: | InChI=1/C6H6BrNO/c1-4-2-3-5(9)6(7)8-4/h2-3,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.655g/cm3 |
| Refractive index: | 1.598 |
| Specification: |
The 2-Bromo-3-hydroxy-6-methylpyridine, with the CAS registry number 23003-35-2, has the systematic name and IUPAC name of 2-bromo-6-methylpyridin-3-ol. It belongs to the product category of Pyridine. And the molecular formula of the chemical is C6H6BrNO. The characteristics of 2-Bromo-3-hydroxy-6-methylpyridine are as followings: (1)ACD/LogP: 1.25; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 33.12 Å2; (7)Index of Refraction: 1.598; (8)Molar Refractivity: 38.741 cm3; (9)Molar Volume: 113.547 cm3; (10)Polarizability: 15.358×10-24cm3; (11)Surface Tension: 51.769 dyne/cm; (12)Density: 1.656 g/cm3; (13)Flash Point: 142.361 °C; (14)Enthalpy of Vaporization: 57.476 kJ/mol; (15)Boiling Point: 311.781 °C at 760 mmHg; (16)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
