| Identification | |
| Name: | Pyridine,1,2,3,6-tetrahydro-1-methyl-4-phenyl-, hydrochloride (1:1) |
| Synonyms: | Pyridine,1,2,3,6-tetrahydro-1-methyl-4-phenyl-, hydrochloride (8CI,9CI); 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridinehydrochloride |
| CAS: | 23007-85-4 |
| Molecular Formula: | C12H15 N . Cl H |
| Molecular Weight: | 209.74 |
| InChI: | InChI=1/C12H15N.ClH/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-7H,8-10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 105.8°C |
| Boiling Point: | 258.6°Cat760mmHg |
| Density: | g/cm3 |
| Packinggroup: | III |
| Flash Point: | 105.8°C |
| Usage: |
1,2,3,6-Tetrahydro-1-methyl-4-phenylpyridine hydrochloride (CAS NO.23007-85-4) is used as a dopaminergic neurotoxin that reportedly causes a severe and irreversible Parkinsonian condition in humans and monkeys. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
