| Identification | |
| Name: | 1H-Imidazole,1-(4-nitrophenyl)- |
| Synonyms: | Imidazole,1-(p-nitrophenyl)- (7CI,8CI); 1-(4-Nitrophenyl)-1H-imidazole;1-(4-Nitrophenyl)imidazole; 1-(p-Nitrophenyl)imidazole;4-(1H-Imidazol-1-yl)-1-nitrobenzene; 4-(Imidazol-1-yl)nitrobenzene |
| CAS: | 2301-25-9 |
| Molecular Formula: | C9H7 N3 O2 |
| Molecular Weight: | 189.17 |
| InChI: | InChI=1/C9H7N3O2/c13-12(14)9-3-1-8(2-4-9)11-6-5-10-7-11/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180.1°C |
| Boiling Point: | 374.1°Cat760mmHg |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.65 |
| Specification: |
1H-Imidazole,1-(4-nitrophenyl)- , its cas register number is 2301-25-9. It also can be called 1-(4-Nitrophenyl)-1H-imidazole ; Imidazole, 1-(p-nitrophenyl)- ; and 1-(4-Nitrophenyl)-1H-imidazole (9CI) . Its classification code is Mutation data. |
| Flash Point: | 180.1°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
