| Identification | |
| Name: | 1H-Imidazole,4,5-dibromo- |
| Synonyms: | Imidazole,4,5-dibromo- (7CI,8CI); 4,5-Dibromoimidazole |
| CAS: | 2302-30-9 |
| Molecular Formula: | C3H2 Br2 N2 |
| Molecular Weight: | 225.87 |
| InChI: | InChI=1/C11H8BrNO/c12-9-6-11(8-13-7-9)14-10-4-2-1-3-5-10/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 214-216°C |
| Flash Point: | 188.8°C |
| Boiling Point: | 388.6°Cat760mmHg |
| Density: | 2.419 |
| Refractive index: | 1.607 |
| Specification: |
1H-Imidazole,4,5-dibromo- , its cas register number is 2302-30-9. It also can be called 4,5-Dibromo-1H-imidazole ; and 4,5-Dibromoimidazole . |
| Flash Point: | 188.8°C |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
