Identification |
Name: | Ethanone,1-(4-chlorophenyl)-2-[[3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylamino]- |
Synonyms: | Acetophenone,4'-chloro-2-[[3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylamino]-(8CI);5-[3-[N-Methyl-N-(p-chlorophenacyl)amino]propyl]-10,11-dihydro-5H-dibenz[b,f]azepine;Amplit; Leo 640; Lofepramine; Lopramine |
CAS: | 23047-25-8 |
EINECS: | 245-396-8 |
Molecular Formula: | C26H27 Cl N2 O |
Molecular Weight: | 0 |
InChI: | InChI=1/C26H27ClN2O/c1-28(19-26(30)22-13-15-23(27)16-14-22)17-6-18-29-24-9-4-2-7-20(24)11-12-21-8-3-5-10-25(21)29/h2-5,7-10,13-16H,6,11-12,17-19H2,1H3 |
Molecular Structure: |
![(C26H27ClN2O) Acetophenone,4'-chloro-2-[[3-(10,11-dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]methylamino]-(8CI);5-[3...](https://img1.guidechem.com/chem/e/dict/111/23047-25-8.jpg) |
Properties |
Flash Point: | 301.6°C |
Boiling Point: | 575°Cat760mmHg |
Density: | 1.173g/cm3 |
Refractive index: | 1.607 |
Biological Activity: | Serotonin and noradrenalin re-uptake inhibitor (SNRI) that is metabolized to desipramine. Produces inhibition of liver tryptophan pyrollase activity in vitro and displays antidepressant properties in vivo . |
Flash Point: | 301.6°C |
Usage: | Psychotropic drug related to imipramine. Antidepressant |
Safety Data |
|
 |