| Identification | |
| Name: | Pentanamide,N-(3-chloro-4-methylphenyl)-2-methyl- |
| Synonyms: | p-Valerotoluidide,3'-chloro-2-methyl- (6CI,8CI); 3'-Chloro-2,4'-dimethylvaleranilide;3'-Chloro-2-methyl-p-valerotoluidide; CMA; CMMP; CMMP (herbicide); Chlorpentan;Dutom; Hortox; N-(3-Chloro-4-methylphenyl)-2-methylpentanamide; Niagara 4512;Pentanochlor; Solan; Solan (herbicide); Solane |
| CAS: | 2307-68-8 |
| EINECS: | 218-988-9 |
| Molecular Formula: | C13H18 Cl N O |
| Molecular Weight: | 239.77 |
| InChI: | InChI=1/C13H18ClNO/c1-4-5-10(3)13(16)15-11-7-6-9(2)12(14)8-11/h6-8,10H,4-5H2,1-3H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN1648 3/PG 2 |
| Flash Point: | 181.3°C |
| Boiling Point: | 376.2°C at 760 mmHg |
| Density: | 1.104g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
Solan (CAS NO.2307-68-8) is also called Pentanochlor [BSI:ISO] ; 3'-Chloro-2-methyl-p-valerotoluidide ; BRN 2722779 ; CMMP ; Caswell No. 800 ; Chlorpentan ; Dakuron ; EPA Pesticide Chemical Code 020901 ; FMC 4512 ; Hortox ; N-(3-Chlor-methylphenyl)-2-methylpentanamid ; N-(3-Chlor-methylphenyl)-2-methylpentanamid [German] ; N-(3-Chloro-4-methylphenyl)-2-methylpentamide ; N-(3-Chloro-4-methylphenyl)-2-methylpentanamide ; N-(3-Chloro-p-tolyl)-2-methylvaleramide ; Niagara 4512 ; Pentachlore ; Pentanamide, N-(3-chloro-4-methylphenyl)-2-methyl- ; Pentanochlor ; Pentanochlore ; Pentanochlore [ISO-French] . Solan (CAS NO.2307-68-8) is moderate toxic. It will produce toxic chloride and nitrogen oxide gaswhen buring. So the storage environment should be ventilate, low-temperature and dry. Keep Solan (CAS NO.2307-68-8) separate from raw materials of food. |
| Flash Point: | 181.3°C |
| Safety Data | |
 |
|
