Identification |
Name: | Benzothiazole,2-(butylthio)- |
Synonyms: | 2-Butylthiobenzothiazole;Butylcaptax; Captax, butyl- |
CAS: | 2314-17-2 |
Molecular Formula: | C11H13 N S2 |
Molecular Weight: | 223.37 |
InChI: | InChI=1/C11H13NS2/c1-2-3-8-13-11-12-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 159.6°C |
Boiling Point: | 340.4°Cat760mmHg |
Density: | 1.19g/cm3 |
Refractive index: | 1.633 |
Specification: |
Butylcaptax ,its cas register number is 2314-17-2. It also can be called Benzothiazole, 2-(butylthio)- ; and 2-(Butylthio)benzothiazole .
|
Flash Point: | 159.6°C |
Safety Data |
|
 |