| Identification | |
| Name: | Benzothiazole,2-(butylthio)- |
| Synonyms: | 2-Butylthiobenzothiazole;Butylcaptax; Captax, butyl- |
| CAS: | 2314-17-2 |
| Molecular Formula: | C11H13 N S2 |
| Molecular Weight: | 223.37 |
| InChI: | InChI=1/C11H13NS2/c1-2-3-8-13-11-12-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.6°C |
| Boiling Point: | 340.4°Cat760mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.633 |
| Specification: |
Butylcaptax ,its cas register number is 2314-17-2. It also can be called Benzothiazole, 2-(butylthio)- ; and 2-(Butylthio)benzothiazole . |
| Flash Point: | 159.6°C |
| Safety Data | |
 |
|
