| Identification | |
| Name: | phenol, compound with 2,2',2''-nitrilotris[ethanol] (1:1) |
| Synonyms: | Phenol, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2,2',2''-Nitrilotrisethanol phenolate;Triethanolamine phenolate;Phenol, compound with 2,2',2''-nitrilotris(ethanol) (1:1);Ethanol, 2,2',2''-nitrilotri-, compd. with phenol (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium phenolate |
| CAS: | 23184-71-6 |
| EINECS: | 245-478-3 |
| Molecular Formula: | C12H21NO4 |
| Molecular Weight: | 243.2994 |
| InChI: | InChI=1/C6H15NO3.C6H6O/c8-4-1-7(2-5-9)3-6-10;7-6-4-2-1-3-5-6/h8-10H,1-6H2;1-5,7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
