| Identification | |
| Name: | Benzenecarbothioamide,2-(acetyloxy)-3-bromo-N-(4-bromophenyl)-5-chloro- |
| Synonyms: | Salicylanilide,3,4'-dibromo-5-chlorothio-, acetate (ester) (8CI); 2-Acetoxy-3-bromo-5-chloro-N-(4'-bromophenyl)thiobenzamide;3,4'-Dibromo-5-chlorothiosalicylanilide acetate; 71-0726; BAY 4059; BAY-Va4059; Brotianide; Dirian |
| CAS: | 23233-88-7 |
| EINECS: | 245-505-9 |
| Molecular Formula: | C15H10 Br2 Cl N O2 S |
| Molecular Weight: | 463.59 |
| InChI: | InChI=1/C15H10Br2ClNO2S/c1-8(20)21-14-12(6-10(18)7-13(14)17)15(22)19-11-4-2-9(16)3-5-11/h2-7H,1H3,(H,19,22) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 264.7°C |
| Boiling Point: | 514.1°Cat760mmHg |
| Density: | 1.795g/cm3 |
| Refractive index: | 1.699 |
| Specification: |
The extinguishing agent of Brotianide (CAS NO.23233-88-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 264.7°C |
| Safety Data | |
 |
|
