Identification |
Name: | L-Serine,N-[[(4-methoxyphenyl)methoxy]carbonyl]-, pentachlorophenyl ester (9CI) |
Synonyms: | Serine,N-carboxy-, N-(p-methoxybenzyl) pentachlorophenyl ester, L- (8CI); Benzylalcohol, p-methoxy-, N-ester with N-carboxy-L-serine pentachlorophenyl ester(8CI); Phenol, pentachloro-, ester with N-carboxy-L-serine N-(p-methoxybenzyl)ester (8CI) |
CAS: | 23234-97-1 |
EINECS: | 245-508-5 |
Molecular Formula: | C18H14 Cl5 N O6 |
Molecular Weight: | 517.57186 |
InChI: | InChI=1/C18H14Cl5NO6/c1-28-9-4-2-8(3-5-9)7-29-18(27)24-10(6-25)17(26)30-16-14(22)12(20)11(19)13(21)15(16)23/h2-5,10,25H,6-7H2,1H3,(H,24,27) |
Molecular Structure: |
|
Properties |
Flash Point: | 361.7°C |
Boiling Point: | 674.5°Cat760mmHg |
Density: | 1.562g/cm3 |
Refractive index: | 1.604 |
Flash Point: | 361.7°C |
Safety Data |
|
|