| Identification | |
| Name: | 2-Piperidinemethanol, a-phenyl-, acetate (ester),hydrochloride, (aR,2R)-rel-(-)-(9CI) |
| Synonyms: | 2-Piperidinemethanol,a-phenyl-, acetate (ester),hydrochloride, (-)- (8CI); 2-Piperidinemethanol, a-phenyl-, acetate (ester), hydrochloride,(R*,R*)-(-)-; 8228RP; Levophacetoperane hydrochloride; Lidepran; Lidepranhydrochloride |
| CAS: | 23257-56-9 |
| EINECS: | 245-536-8 |
| Molecular Formula: | C14H19 N O2 . Cl H |
| Molecular Weight: | 269.80 |
| InChI: | InChI=1/C14H19NO2.ClH/c1-11(16)17-14(12-7-3-2-4-8-12)13-9-5-6-10-15-13;/h2-4,7-8,13-15H,5-6,9-10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 150.4°C |
| Boiling Point: | 325.1°Cat760mmHg |
| Density: | 1.07g/cm3 |
| Report: |
Reported in 27ZQAG "Psychotropic Drugs and Related Compounds," 2nd ed., Usdin, E., and D.H. Efron, Washington, DC, 1972 Volume(issue)/page/year: -,254,1972 |
| Flash Point: | 150.4°C |
| Safety Data | |
 |
|
