| Identification | |
| Name: | 2-Propenoic acid,3-(4-formylphenyl)- |
| Synonyms: | Cinnamicacid, p-formyl- (8CI);3-(4-Formylphenyl)acrylic acid;NSC 74480;p-Formylcinnamic acid; |
| CAS: | 23359-08-2 |
| EINECS: | 245-608-9 |
| Molecular Formula: | C10H8O3 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C10H8O3/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-7H,(H,12,13)/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.288 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | white crystalline powder |
| Specification: |
?p-Formylcinnamicacid , its cas register number is 23359-08-2. It also can be called?3-(4-Formylphenyl)acrylic acid ; 4-Formylcinnamic acid . It is a?light yellow to beige crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
