| Identification | |
| Name: | 1H-Benzotriazole,6-nitro- |
| Synonyms: | 1H-Benzotriazole,5-nitro- (8CI,9CI); Benzotriazole, 5-nitro- (6CI,7CI);5-Nitro-1H-benzotriazole; 5-Nitrobenzotriazole; 6-Nitro-1H-benzotriazole;6-Nitrobenzotriazole; NSC 3132; NSC 66476; Verzone N-BTA |
| CAS: | 2338-12-7 |
| EINECS: | 219-047-5 |
| Molecular Formula: | C6H4 N4 O2 |
| Molecular Weight: | 164.14 |
| InChI: | InChI=1/C6H4N4O2/c11-10(12)4-1-2-5-6(3-4)8-9-7-5/h1-3H,(H,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 385 |
| Flash Point: | 191.3°C |
| Boiling Point: | 392.7°Cat760mmHg |
| Density: | 1.638g/cm3 |
| Refractive index: | 1.761 |
| Specification: | Safety Statements:16-17-36/37/39 16:Keep away from sources of ignition - No smoking 17:Keep away from combustible material 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 191.3°C |
| Safety Data | |
 |
|
