| Identification | |
| Name: | 1H-Inden-2-amine,2,3-dihydro-, hydrochloride (1:1) |
| Synonyms: | 1H-Inden-2-amine,2,3-dihydro-, hydrochloride (9CI);2-Indanamine, hydrochloride (8CI);(2,3-Dihydro-1H-inden-2-yl)amine hydrochloride;2,3-Dihydro-1H-inden-2-aminehydrochloride;2-Amino-2,3-dihydro-1H-indene hydrochloride;2-Aminoindanhydrochloride;2-Aminoindan monohydrochloride;Indan-2-ylamine hydrochloride;SU 8629 hydrochloride; |
| CAS: | 2338-18-3 |
| EINECS: | 219-048-0 |
| Molecular Formula: | C9H12ClN |
| Molecular Weight: | 169.65 |
| InChI: | InChI=1/C9H11N.ClH/c10-9-5-7-3-1-2-4-8(7)6-9;/h1-4,9H,5-6,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 96.8°C |
| Boiling Point: | 226.2°Cat760mmHg |
| Density: | 1.056g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Off-white powder. |
| Specification: |
2-Aminoindane hydrochloride with CAS registry number of 2338-18-3 is off-white powder, known as 2,3-Dihydro-1H-inden-2-amine hydrochloride ; 2-Aminoindan hydrochloride ; 2-Indanylamine hydrochloride ; Su 8629 hydrochloride ; 1H-Inden-2-amine, 2,3-dihydro-, hydrochloride (9CI) ; 2-Indanamine, hydrochloride ; Indan-2-ylammonium chloride . It is incompatible with oxidizing agents. When heated to decomposition, it yields Hydrogen chloride , Nitrogen oxides, Carbon monoxide , irritating and toxic fumes and gases, Carbon dioxide . |
| Packinggroup: | I; II; III |
| Flash Point: | 96.8°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
