| Identification |
| Name: | Benzoic acid,3,4,5-triiodo- |
| Synonyms: | 3,4,5-Triiodobenzoicacid;NSC 11811; |
| CAS: | 2338-20-7 |
| EINECS: | 219-050-1 |
| Molecular Formula: | C7H3I3O2 |
| Molecular Weight: | 499.8109 |
| InChI: | InChI=1/C7H3I3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)/p-1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 2.971 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | almost white to light gray powder |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
