| Identification | |
| Name: | Phenol,2,4,6-trichloro-, 1-acetate |
| Synonyms: | Phenol,2,4,6-trichloro-, acetate (6CI,7CI,8CI,9CI); 2,4,6-Trichlorophenol acetate;2,4,6-Trichlorophenyl acetate; NSC 21474 |
| CAS: | 23399-90-8 |
| Molecular Formula: | C8H5 Cl3 O2 |
| Molecular Weight: | 239.48 |
| InChI: | InChI=1/C8H5Cl3O2/c1-4(12)13-8-6(10)2-5(9)3-7(8)11/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.469 g/cm3 |
| Refractive index: | 1.554 |
| Specification: |
2,4,6-Trichlorophenyl acetate ,its cas register number is 23399-90-8. It also can be called Phenol, 2,4,6-trichloro-, acetate ;and 2,4,6-Trichlorophenyl-acetate . |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
