Identification |
Name: | L-Phenylalanine,pentachlorophenyl ester, hydrobromide (9CI) |
Synonyms: | Alanine,phenyl-, pentachlorophenyl ester, hydrobromide, L- (8CI); Phenol, pentachloro-,ester with L-phenylalanine hydrobromide (8CI); NSC 120016 |
CAS: | 23404-47-9 |
Molecular Formula: | C15H10 Cl5 N O2 . Br H |
Molecular Weight: | 413.5104 |
InChI: | InChI=1/C15H10Cl5NO2/c16-9-10(17)12(19)14(13(20)11(9)18)23-15(22)8(21)6-7-4-2-1-3-5-7/h1-5,8H,6,21H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 278.1°C |
Boiling Point: | 536.2°Cat760mmHg |
Density: | 1.542g/cm3 |
Refractive index: | 1.624 |
Flash Point: | 278.1°C |
Safety Data |
|
 |