| Identification | |
| Name: | 4-Quinolinol,6-chloro- |
| Synonyms: | 6-Chloro-4-quinolinol;NSC 4472 |
| CAS: | 23432-43-1 |
| Molecular Formula: | C9H6 Cl N O |
| Molecular Weight: | 179.6 |
| InChI: | InChI=1/C9H6ClNO/c10-6-1-2-8-7(5-6)9(12)3-4-11-8/h1-5H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.4 ºC |
| Boiling Point: | 306.9 ºC at 760 mmHg |
| Density: | 1.339 g/cm3 |
| Refractive index: | 1.608 |
| Specification: |
6-Chloroquinolin-4-ol , with CAS number of 23432-43-1, can be called 4-quinolinol, 6-chloro- ; 6-Chloro-4-Hydroxyquinoline ; 6-Chloro-4-quinolinol . |
| Flash Point: | 139.4 ºC |
| Safety Data | |
| Hazard Symbols |
E: Explosive
|
 |
|
