5H-Pyrrolo[3,4-b]pyridine-5,7(6H)-dione,6-hydroxy- (23439-87-4)

 6-Hydroxy-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione ,its cas register number is 23439-87-4. Systematic name about this chemicals is 6-hydroxy-5H-pyrrolo[3,4-b]pyridine-5,7(6H)-dione .The index of refraction about it is 1.737, molar refractivity is 37.32 cm³ , molar volume is 92.7 cm³ and surface tension is 111.7 dyne/cm, also, it have other chemical properties, for example, the enthalpy of vaporization about this chemicals is 71.23 kJ/mol, vapour pressure is 7.32E-08 mmHg at 25°C and so on.

This chemicals can be described computed from structure:
1) SMILES: O=C2c1cccnc1C(=O)N2O
2) InChI: InChI=1/C7H4N2O3/c10-6-4-2-1-3-8-5(4)7(11)9(6)12/h1-3,12H
3) InChIKey: XCLIICWPGQIRDA-UHFFFAOYAY