| Identification |
| Name: | Benzenepropanol, a-methyl- |
| Synonyms: | 1-Methyl-3-phenyl-1-propanol;1-Phenyl-3-butanol;2-Hydroxy-4-phenylbutane;NSC 69076;a-Methylbenzenepropanol;2-Butanol,4-phenyl- (6CI,7CI,8CI); |
| CAS: | 2344-70-9 |
| EINECS: | 219-055-9 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C10H14O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.97 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5157-1.5177 |
| Solubility: | Insoluble |
| Appearance: | colourless oily liquid with a floral-fruity, herbaceous odour |
| HS Code: | 29062900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| |
 |
