| Identification | |
| Name: | Benzene,1,2,4,5-tetrabromo-3,6-dimethyl- |
| Synonyms: | p-Xylene,2,3,5,6-tetrabromo- (6CI,8CI); 1,2,4,5-Tetrabromo-3,6-dimethylbenzene;1,4-Dimethyltetrabromobenzene; 2,3,5,6-Tetrabromo-1,4-dimethylbenzene;2,3,5,6-Tetrabromo-p-xylene |
| CAS: | 23488-38-2 |
| EINECS: | 245-688-5 |
| Molecular Formula: | C8H6 Br4 |
| Molecular Weight: | 421.78 |
| InChI: | InChI=1/C8H6Br4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Melting Point: | 254-256 °C(lit.) |
| Flash Point: | 167.7°C |
| Boiling Point: | 361.3°Cat760mmHg |
| Density: | 2.258g/cm3 |
| Refractive index: | 1.632 |
| Specification: |
Tetrabromo-p-xylene with CAS registry number of 23488-38-2 is also called for 1,4-Bis(dibrommethyl)benzen ; 1,4-Bis(dibrommethyl)benzen [Czech] ; 1,4-Dimethyltetrabromobenzene ; 2,3,5,6-Tetrabromo-p-xylene ; 3-05-00-00860 (Beilstein Handbook Reference) ; Tetrabromo-p-xylen ; Tetrabromo-p-xylen [Czech] ; p-TBX ; p-Xylene, 2,3,5,6-tetrabromo- (6CI,8CI) ; p-Xylene, alpha,alpha,alpha',alpha'-tetrabromo- ; Benzene, 1,2,4,5-tetrabormo-3,6-dimethyl- (9CI) ; Benzene, 1,2,4,5-tetrabromo-3,6-dimethyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 167.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
