| Identification | |
| Name: | Piperidinium,1-ethyl-1-heptyl-, bromide (1:1) |
| Synonyms: | Piperidinium,1-ethyl-1-heptyl-, bromide (8CI,9CI); 1-Ethyl-1-heptylpiperidinium bromide; NSC268365 |
| CAS: | 23489-00-1 |
| Molecular Formula: | C14H30 N . Br |
| Molecular Weight: | 292.36 |
| InChI: | InChI=1/C14H30N/c1-3-5-6-7-9-12-15(4-2)13-10-8-11-14-15/h3-14H2,1-2H3/q+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
1-Ethyl-1-heptylpiperidinium bromide with cas registry number of 23489-00-1 is also known as Piperidinium, 1-ethyl-1-heptyl-, bromide ; 1-Ethyl-1-heptylpiperidinium bromide . It should be stored in a cool, dry place. 1-Ethyl-1-heptylpiperidinium bromide with cas registry number of 23489-00-1 is used as a drug . It is also used as an intermediate in synthesis of many useful compounds. |
| Flash Point: | °C |
| Safety Data | |
 |
|
