| Identification | |
| Name: | Propanoic acid,2-methyl-, hexyl ester |
| Synonyms: | Isobutyricacid, hexyl ester (7CI,8CI); 1-Hexyl isobutyrate; Hexyl 2-methylpropanoate;Hexyl 2-methylpropionate; Hexyl isobutanoate; Hexyl isobutyrate; NSC 46108;n-Hexyl iso-butyrate; n-Hexyl isobutyrate |
| CAS: | 2349-07-7 |
| EINECS: | 219-075-8 |
| Molecular Formula: | C10H20 O2 |
| Molecular Weight: | 172.26 |
| InChI: | InChI=1/C10H20O2/c1-4-5-6-7-8-12-10(11)9(2)3/h9H,4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 164? |
| Density: | 0.86 |
| Refractive index: | 1.413 |
| Appearance: | Colorless liquid with fresh apple-pineapple like odor |
| Specification: |
N-Hexyl Isobutyrate (CAS NO.2349-07-7) is a colorless clear liquid. To protect yourself,you can take eyeshields, full-face respirator (US), gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 164? |
| Safety Data | |
 |
|
