| Identification | |
| Name: | Ethanol, 2-phenoxy-,1-propanoate |
| Synonyms: | Ethanol,2-phenoxy-, propanoate (9CI); Ethanol, 2-phenoxy-, propionate (7CI,8CI);2-Phenoxyethyl propionate; Ethylene glycol monophenyl ether propionate; NSC6707; Phenoxyethyl propionate |
| CAS: | 23495-12-7 |
| EINECS: | 245-692-7 |
| Molecular Formula: | C11H14 O3 |
| Molecular Weight: | 194.25 |
| InChI: | InChI=1/C11H14O3/c1-3-11(12)14-9(2)13-10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.9°C |
| Boiling Point: | 261.9°Cat760mmHg |
| Density: | 1.061g/cm3 |
| Refractive index: | n20/D 1.502(lit.) |
| Specification: |
Ethyleneglycol monophenyl ether propionate , its cas register number is 23495-12-7. It also can be called 2-Phenoxyethanol propionate ; 3-06-00-00571 (Beilstein Handbook Reference) ; AI3-02105 ; BRN 2214059 ; EINECS 245-692-7 ; NSC 6707 ; Phenoxyethyl propionate ; Propionic acid, 2-phenoxyethyl ester . When Ethyleneglycol monophenyl ether propionate (CAS NO.23495-12-7) is heated to decomposition, it emits acrid smoke and irritating fumes. |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Flash Point: | 103.9°C |
| Safety Data | |
 |
|
