| Identification | |
| Name: | 2-Propenoicacid, 2-methyl-, 1,1'-(oxydi-2,1-ethanediyl) ester |
| Synonyms: | 2-Propenoicacid, 2-methyl-, oxydi-2,1-ethanediyl ester (9CI);Methacrylic acid, diesterwith diethylene glycol (6CI);Methacrylic acid, oxydiethylene ester (7CI,8CI);Diethylene glycol, dimethacrylate (8CI);2,2'-Oxybisethanol dimethacrylate;2,2'-Oxydiethyl dimethacrylate;2G;Blemmer PDE 100;DGM 2;Diethylene glycolbis(methacrylate);Light Ester 2EG;NK Ester 2G;Oxydiethylene methacrylate;PDE 100;SR 231;SR 231E;TGM 2; |
| CAS: | 2358-84-1 |
| EINECS: | 219-099-9 |
| Molecular Formula: | C12H18 O5 |
| Molecular Weight: | 242.27 |
| InChI: | InChI=1/C12H18O5/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Flash Point: | >110 ºC |
| Boiling Point: | 134 ºC (2 mmHg) |
| Density: | 1.082 |
| Stability: | No data. |
| Refractive index: | 1.458 |
| Appearance: | Colorless liquid. Ester-like odor. |
| Specification: |
Diethylene glycol bis(methacrylate) , its cas register number is 2358-84-1. It also can be called Diethylene glycol dimethacrylate monomer ; 2-Propenoic acid, 2-methyl-, oxydi-2,1-ethanediyl ester ; CCRIS 7050 ; DGM 2 ; Diethylene glycol dimethacrylate ; Diethyleneglycol dimethacrylate ; HSDB 5458 ; Methacrylic acid, oxydiethylene ester ; Oxydiethylene methacrylate ; TGM 2 ; 2-Propenoic acid, 2-methyl-, 1,1'-(oxydi-2,1-ethanediyl) ester ; 2-Propenoic acid, 2-methyl-, oxydi-2,1-ethanediyl ester ; Oxydi-2,1-ethanediyl bismethacrylate . It is a colorless liquid with ester-like odor. |
| Flash Point: | >110 ºC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Colorless liquid |
| Usage: | Crosslinked acrylicvinyl resin comonomer. |
| Safety Data | |
 |
|
