Identification |
Name: | Benzoic acid,4-bromo-3-nitro-, methyl ester |
Synonyms: | 4-Bromo-3-nitrobenzoicacid methyl ester;4-Bromo-3-nitrobenzoic acid methyl ester; |
CAS: | 2363-16-8 |
Molecular Formula: | C8H6BrNO4 |
Molecular Weight: | 260.04 |
InChI: | InChI=1/C8H6BrNO4/c1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 102-103oC |
Density: | 1.673 g/cm3 |
Refractive index: | 1.587 |
Appearance: | colorless crystals |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |