| Identification |
| Name: | Benzoic acid,4-ethoxy-, ethyl ester |
| Synonyms: | Benzoicacid, p-ethoxy-, ethyl ester (6CI,7CI,8CI);4-Ethoxy ethylbenzoate;4-Ethoxybenzoic acid ethyl ester;Ethyl 4-ethoxybenzoate;Ethylp-ethoxybenzoate;NSC 405367;p-Ethoxyethyl benzoate;4-Ethoxy ethylbenzoate;Ethyl 4-Ethoxybenzoate;benzoic acid, 4-ethoxy-, ethyl ester; |
| CAS: | 23676-09-7 |
| EINECS: | 245-818-0 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C11H14O3/c1-3-13-10-7-5-9(6-8-10)11(12)14-4-2/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.071 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.517-1.519 |
| Water Solubility: | insoluble Stability Stable. Incompatible with strong oxidizing agents.Combustible. Toxicology May act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: | insoluble |
| Appearance: | colourless viscous liquid |
| Safety Data |
| |
 |
