| Identification | |
| Name: | Phosphonic acid,di-2-propen-1-yl ester |
| Synonyms: | Allylphosphonate (6CI); Phosphonic acid, di-2-propenyl ester (9CI); Phosphonic acid,diallyl ester (8CI); Diallyl hydrogen phosphite; Diallyl phosphite; Diallylphosphonate; NSC 512600 |
| CAS: | 23679-20-1 |
| Molecular Formula: | C6H11 O3 P |
| Molecular Weight: | 162.12 |
| InChI: | InChI=1S/C6H11O3P/c1-3-5-8-10(7)9-6-4-2/h3-4,10H,1-2,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Diallyl phosphite with cas registry number of 23679-20-1 is also known as Phosphonic acid, di-2-propen-1-yl ester; Allyl phosphonate (6CI); Phosphonic acid, di-2-propenyl ester (9CI); Phosphonic acid, diallyl ester (8CI); Diallyl hydrogen phosphite; Diallyl phosphonate; NSC 512600 . |
| Safety Data | |
 |
|
