Identification |
Name: | 2-Propenoic acid,2-methyl-, 2-(1-methylethoxy)-2-oxoethyl ester |
Synonyms: | Methacrylicacid, ester with isopropyl glycolate (8CI); (Isopropoxycarbonyl)methylmethacrylate; Carbisopropoxymethyl methacrylate; Methacrylic acid, ester withisopropyl hydroxyacetate |
CAS: | 23684-11-9 |
Molecular Formula: | C9H14 O4 |
Molecular Weight: | 186.2051 |
InChI: | InChI=1/C9H14O4/c1-6(2)9(11)13-8(10)5-12-7(3)4/h7H,1,5H2,2-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 113.4°C |
Boiling Point: | 268.2°Cat760mmHg |
Density: | 1.038g/cm3 |
Refractive index: | 1.435 |
Flash Point: | 113.4°C |
Safety Data |
|
 |