| Identification | |
| Name: | Phenylalanine,2-hydroxy- |
| CAS: | 2370-61-8 |
| EINECS: | 219-134-8 |
| Molecular Formula: | C9H11 N O3 |
| Molecular Weight: | 181.19 |
| InChI: | InChI=1/C9H11NO3/c10-7(9(12)13)5-6-3-1-2-4-8(6)11/h1-4,7,11H,5,10H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177°C |
| Boiling Point: | 369°Cat760mmHg |
| Density: | 1.333g/cm3 |
| Appearance: | Off-white solid |
| Specification: |
o-Tyrosine, DL- (CAS NO.2370-61-8), its Synonyms are Alanine, 3-(o-hydroxyphenyl)-, DL ; DL-3-(o-Hydroxyphenyl)alanine ; DL-o-Tyrosine ; 2-Hydroxyphenylalanine . |
| Flash Point: | 177°C |
| Usage: |
o-Tyrosine, DL- (CAS NO.2370-61-8) is used as a precursor in the formation of catecholamines. |
| Safety Data | |
 |
|
