Identification |
Name: | 2-Propenoic acid,3-(1,3-benzodioxol-5-yl)- |
Synonyms: | Cinnamicacid, 3,4-(methylenedioxy)- (6CI,7CI,8CI);3,4-(Methylenedioxy)benzene-3-acrylic acid;3-(1,3-Benzodioxol-5-yl)-2-propenoic acid;3-(1,3-Benzodioxol-5-yl)acrylicacid;3-(3,4-Methylenedioxyphenyl)propenoic acid;3-(Benzodioxol-5-yl)acrylicacid;3',4'-Methylenedioxycinnamic acid;Cinnamic acid,3,4-[methylenebis(oxy)]-;NSC 5953;Piperonylideneacetic acid; |
CAS: | 2373-80-0 |
EINECS: | 219-151-0 |
Molecular Formula: | C10H8O4 |
Molecular Weight: | 192.17 |
InChI: | InChI=1/C10H8O4/c11-10(12)4-2-7-1-3-8-9(5-7)14-6-13-8/h1-5H,6H2,(H,11,12)/b4-2- |
Molecular Structure: |
 |
Properties |
Density: | 1.41 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | Very soluble |
Appearance: | White to light beige. |
Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |