| Identification | |
| Name: | 5H-Cyclopentapyrazine,6,7-dihydro-5-methyl- |
| Synonyms: | 5-Methyl-6,7-dihydro-5H-cyclopenta(b)pyrazine;5-Methyl-6,7-dihydro-5H-cyclopentylpyrazine;5H-5-methyl-6.7-dihydrocylope ntapyrazine; |
| CAS: | 23747-48-0 |
| EINECS: | 245-864-1 |
| Molecular Formula: | C8H10N2 |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C8H10N2/c1-6-2-3-7-8(6)10-5-4-9-7/h4-6H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.055 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5295 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear yellow to yellow-orange to brown liquid |
| Specification: |
5H-Cyclopentapyrazine,6,7-dihydro-5-methyl- (CAS NO.23747-48-0), its Synonyms are 5-Methyl-6,7-dihydro-5H-cyclopentapyrazine ; 5H-5-Methyl-6,7-dihydrocyclopenta(b)pyrazine ; 5H-5-Methyl-6,7-dihydrocyclopentapyrazine ; 6,7-Dihydro-5-methyl-5H-cyclopentapyrazine . |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
