Identification |
Name: | 6H-Pyrazolo[3,4-d]pyrimidine-6-thione,4-amino-1,7-dihydro- |
Synonyms: | 1H-Pyrazolo[3,4-d]pyrimidine-6-thiol,4-amino- (6CI,8CI);6H-Pyrazolo[3,4-d]pyrimidine-6-thione, 4-amino-1,5-dihydro-(9CI);NSC 7790; |
CAS: | 23771-52-0 |
EINECS: | 245-872-5 |
Molecular Formula: | C5H5N5S |
Molecular Weight: | 167.18 |
InChI: | InChI=1/C5H5N5S/c6-3-2-1-7-10-4(2)9-5(11)8-3/h1H,(H4,6,7,8,9,10,11) |
Molecular Structure: |
![(C5H5N5S) 1H-Pyrazolo[3,4-d]pyrimidine-6-thiol,4-amino- (6CI,8CI);6H-Pyrazolo[3,4-d]pyrimidine-6-thione, 4-ami...](https://img.guidechem.com/casimg/23771-52-0.gif) |
Properties |
Density: | 2.08 g/cm3 |
Refractive index: | 2.07 |
Appearance: | yellow powder |
Usage: | Pyrazolo[3,4-d]pyrimidines have a close structural resemblance to the substrates for the enzyme xanthine oxidase, hypoxanthine (6-hydroxypurine) and xanthine (2,6-dihydroxypurine). These compounds are capable of binding to the enzyme and strongly inhibi |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |