| Identification | |
| Name: | 2,3-Quinoxalinedione,1,4-dihydro-6,7-dinitro- |
| Synonyms: | 2,3-Quinoxalinediol,6,7-dinitro- (7CI,8CI);6,7-Dinitro-2,3-dihydroxyquinoxaline;6,7-Dinitroquinoxaline-2,3-(1H,4H)-dione;DNQX;FG 9041; |
| CAS: | 2379-57-9 |
| Molecular Formula: | C8H4N4O6 |
| Molecular Weight: | 252.14056 |
| InChI: | InChI=1S/C8H4N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H,(H,9,13)(H,10,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.738 g/cm3 |
| Refractive index: | 1.665 |
| Water Solubility: | Soluble in DMSO or 0.1 N NaOH. |
| Solubility: | Soluble in DMSO or 0.1 N NaOH. |
| Appearance: | Off-White Powder with a Yellow Tinge |
| Specification: | Off-White Powder with a Yellow Tinge usageEng:Potent competitive non-NMDA glutamate receptor antagonist |
| Biological Activity: | Water-soluble form of 6,7-Dinitroquinoxaline-2,3-dione . Selective non-NMDA receptor antagonist. |
| Storage Temperature: | Desiccate at RT |
| Usage: | Potent competitive non-NMDA glutamate receptor antagonist |
| Safety Data | |
 |
|
