| Identification |
| Name: | 2-Thiophenecarboxylicacid, 3-methyl- |
| Synonyms: | 3-Methyl-2-thiophenecarboxylic acid |
| CAS: | 23806-24-8 |
| EINECS: | 245-894-5 |
| Molecular Formula: | C6H6O2S |
| Molecular Weight: | 142.18 |
| InChI: | InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 119.5°C |
| Boiling Point: | 274°Cat760mmHg |
| Density: | 1.319g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | White to pale yellow powder. |
| Flash Point: | 119.5°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
