| Identification | |
| Name: | Benz[c]acridine,7,10-dimethyl- |
| Synonyms: | 7,10-Dimethylbenz[c]acridine |
| CAS: | 2381-40-0 |
| Molecular Formula: | C19H15 N |
| Molecular Weight: | 257.35 |
| InChI: | InChI=1/C19H15N/c1-12-7-9-15-13(2)16-10-8-14-5-3-4-6-17(14)19(16)20-18(15)11-12/h3-11H,1-2H3 |
| Molecular Structure: | ![(C19H15N) 7,10-Dimethylbenz[c]acridine](https://img1.guidechem.com/chem/e/dict/39/2381-40-0.jpg) |
| Properties | |
| Melting Point: | 147-149 °C(lit.) |
| Flash Point: | 209.8°C |
| Boiling Point: | 470.2°Cat760mmHg |
| Density: | 1.182g/cm3 |
| Refractive index: | 1.737 |
| Specification: |
6,9-Dimethyl-1,2-benzacridine , its cas register number is 2381-40-0. It also can be called 2,10-Dimethyl-7,8-benzacridine ; 5-20-08-00539 (Beilstein Handbook Reference) ; 7,10-Dimethylbenz(c)acridine ; BRN 0192194 ; CCRIS 991 . 6,9-Dimethyl-1,2-benzacridine (CAS NO.2381-40-0) is harmful by inhalation, in contact with skin and if swallowed. And it's also irritating to eyes and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 209.8°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
