| Identification | |
| Name: | 2-Mercaptobenzoxazole |
| Synonyms: | 2-Benzoxazolethiol(6CI,8CI);2-Benzoxazolinethione (7CI);1,3-Benzoxazole-2(3H)-thione;1,3-Benzoxazole-2-thiol;1,3-Benzoxazoline-2-thione;2,3-Dihydrobenzoxazole-2-thione;2-Benzoxazolethione;2-Benzoxazolylthiol;2-Mercapto-1,3-benzoxazole;2(3H)-Benzoxazolethione;Benzoxazole, 2-mercapto-;Benzoxazolinethione;MBO;NSC 209084;NSC 2128; |
| CAS: | 2382-96-9 |
| EINECS: | 219-191-9 |
| Molecular Formula: | C7H5NOS |
| Molecular Weight: | 151.18 |
| InChI: | InChI=1/C7H5NOS/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H,8,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.4°C |
| Boiling Point: | 247.3°Cat760mmHg |
| Density: | 1.41g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.714 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | SLIGHTLY SOLUBLE |
| Appearance: | Solid. With a stench. |
| HS Code: | 29349990 |
| Flash Point: | 103.4°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
