| Identification | |
| Name: | Ethanone,1-(2,4-dimethyl-1H-pyrrol-3-yl)- |
| Synonyms: | Ketone,2,4-dimethylpyrrol-3-yl methyl (6CI,7CI,8CI);2,4-Dimethyl-3-acetylpyrrole;2,4-Dimethylpyrrol-3-yl methyl ketone;3-Acetyl-2,4-dimethylpyrrole;NSC 10759; |
| CAS: | 2386-25-6 |
| EINECS: | 219-197-1 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-5-4-9-6(2)8(5)7(3)10/h4,9H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112.1°C |
| Boiling Point: | 250.9°Cat760mmHg |
| Density: | 1.04g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Pink powder. |
| Specification: |
3-Acetyl-2,4-dimethyl-pyrrole (2386-25-6) is used as an intermediate in synthesis of many useful compounds. It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, well-ventilated area away from incompatible substances. |
| Flash Point: | 112.1°C |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
