| Identification |
| Name: | Benzenemethanol,2-methyl-3-nitro- |
| Synonyms: | Benzylalcohol, 2-methyl-3-nitro- (8CI);2-Methyl-3-nitrobenzenemethanol; |
| CAS: | 23876-13-3 |
| EINECS: | 245-923-1 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c1-6-7(5-10)3-2-4-8(6)9(11)12/h2-4,10H,5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.272 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.585 |
| Appearance: | white to light yellow crystal powde |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
