| Identification | |
| Name: | 3-Methoxythioanisole |
| Synonyms: | Anisole,m-(methylthio)- (6CI,7CI,8CI);1-Methoxy-3-(methylthio)benzene;3-(Methylthio)-1-methoxybenzene;3-(Methylthio)anisole;3-Methoxyphenyl methylsulfide;Methyl 3-methoxyphenyl sulfide;Methylm-methoxyphenyl sulfide;m-Anisyl methyl sulfide;m-Methoxyphenylmethyl sulfide; |
| CAS: | 2388-74-1 |
| Molecular Formula: | C8H10OS |
| Molecular Weight: | 154.23 |
| InChI: | InChI=1/C8H10O2S/c1-9-7-4-3-5-8(6-7)11-10-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.549 |
| Specification: |
3-Methoxythioanisole , with CAS number of 2388-74-1, can be called Anisole,m-(methylthio)- (6CI,7CI,8CI) ; 1-Methoxy-3-(methylthio)benzene ; 3-(Methylthio)-1-methoxybenzene ; 3-Methoxyphenyl methylsulfide ; Methyl 3-methoxyphenyl sulfide ; m-Methoxyphenylmethyl sulfide ; m-Anisyl methyl sulfide . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
