| Identification |
| Name: | Benzene,1-(bromomethyl)-2,4-difluoro- |
| Synonyms: | Toluene,a-bromo-2,4-difluoro- (8CI);1-(Bromomethyl)-2,4-difluorobenzene;a-Bromo-2,4-difluorotoluene; |
| CAS: | 23915-07-3 |
| EINECS: | 245-938-3 |
| Molecular Formula: | C7H5BrF2 |
| Molecular Weight: | 207.01 |
| InChI: | InChI=1/C7H5BrF2/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Boiling Point: | 28 °C |
| Density: | 1.613 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.524-1.526 |
| Appearance: | Colorless to yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
