| Identification |
| Name: | 4(3H)-Pyrimidinone,5-butyl-2-(ethylamino)-6-methyl- |
| Synonyms: | 4(1H)-Pyrimidinone,5-butyl-2-(ethylamino)-6-methyl- (9CI);5-Butyl-2-(ethylamino)-6-methyl-4(3H)pyrimidinone;5-Butyl-2-ethylamino-6-hydroxy-4-methylpyrimidine;ETH 560;Ethirimol;Milgo;Milgo E;Milstem;Milstem Seed Dressing;NSC 263491;PP 149; |
| CAS: | 23947-60-6 |
| EINECS: | 245-949-3 |
| Molecular Formula: | C11H19N3O |
| Molecular Weight: | 209.2882 |
| InChI: | InChI=1S/C11H19N3O/c1-4-6-7-9-8(3)13-11(12-5-2)14-10(9)15/h4-7H2,1-3H3,(H2,12,13,14,15) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.1 |
| Refractive index: | 1.545 |
| Water Solubility: | Soluble in chloroform, trichlorethylene, acid and alkali solution; slightly soluble in ethanol; practically insoluble in acetone, heat-stable |
| Solubility: | Soluble in chloroform, trichlorethylene, acid and alkali solution; slightly soluble in ethanol; practically insoluble in acetone, heat-stable |
| Appearance: | White crystal |
| Safety Data |
| |
 |
