| Identification | |
| Name: | 3-Hexenoic acid, methylester |
| Synonyms: | Hydrosorbicacid, methyl ester (6CI);Methyl 3-hexenoate;Methyl hex-3-enoate; |
| CAS: | 2396-78-3 |
| EINECS: | 219-256-1 |
| Molecular Formula: | C7H12O2 |
| Molecular Weight: | 128.17 |
| InChI: | InChI=1/C7H12O2/c1-3-4-5-6-7(8)9-2/h4-5H,3,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Melting Point: | -68 |
| Flash Point: | 115 ºF |
| Boiling Point: | 169 ºC |
| Density: | 0.913 |
| Stability: | Stable if stored as directed. |
| Refractive index: | 1.4260 |
| Water Solubility: | Insoluble in water; soluble in alcohol |
| Solubility: | Insoluble in water; soluble in alcohol |
| Appearance: | colorless liquid |
| Specification: |
The Methyl hex-3-enoate with the cas number 2396-78-3 is also called 3-Hexenoic acid, methylester. The IUPAC name is methyl (E)-hex-3-enoate. Its EINECS registry number is 219-256-1. The molecular formula is C7H12O2. This chemical belongs to the following product categories: (1)Alphabetical Listings; (2)Flavors and Fragrances; (3)M-N. The properties of the chemical are: (1)ACD/LogP: 2.06; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 26.3 Å2; (7)Index of Refraction: 1.427; (8)Molar Refractivity: 36.31 cm3; (9)Molar Volume: 141.1 cm3; (10)Polarizability: 14.39×10-24cm3; (11)Surface Tension: 27.2 dyne/cm; (12)Enthalpy of Vaporization: 38.28 kJ/mol; (13)Vapour Pressure: 4.78 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Packinggroup: | III |
| Flash Point: | 115 ºF |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
