| Identification | ||
| Name: | Tolnaftate | |
| Synonyms: | Dungistop;Focusan;Hi-Alarzin;NaphthiomateT;O-2-Naphthyl m,N-dimethylthiocarbanilate;Phytoderm;Pitrex;Sch 10144;Sporiline;Timoped;Tinactin;Tinaderm;Tineacure;Tniaderm;Tolnaphthate;Tolsanil;Tonoftal;Tritin;TolnaftateUSP;Carbamothioicacid, methyl(3-methylphenyl)-, O-2-naphthalenyl ester (9CI);Carbanilic acid, m,N-dimethylthio-,O-2-naphthyl ester (7CI,8CI);2-Naphthyl N-methyl-N-(3-tolyl)thiocarbamate;2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate;2-NaphthylN-methyl-N-m-tolylthiocarbamate;Aftate;Chinofungin;Dermoxin;Dr. Scholl'sAthlete's Foot Spray; | |
| CAS: | 2398-96-1 | |
| EINECS: | 219-266-6 | |
| Molecular Formula: | C19H17NOS | |
| Molecular Weight: | 307.41 | |
| InChI: | InChI=1/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Density: | 1.223 g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.697 | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Appearance: | white powder | |
| Specification: |
Tolnaftate , with CAS number of 2398-96-1, can be called Chinofungin ; Tinaderm ; Sporiline ; Aftate ; 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate ; Methyl-(3-methylphenyl)carbamothioic acid O-2-naphthyl ester ; Tinactin ; Tonoftal . When used to treat tinea pedis, tolnaftate (CAS NO.2398-96-1) has been found to be generally slightly less effective than azoles. However, It is useful when dealing with ringworm, especially when passed from pets to humans. | |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. | |
| Storage Temperature: | 2-8°C | |
| Usage: | Fungicide. | |
| Safety Data | ||
 |
||
