| Identification |
| Name: | 2,3,5,6-tetrachloropyridine |
| Synonyms: | 2,3,5,6-tetrachlopyridine |
| CAS: | 2402-79-1 |
| EINECS: | 219-283-9 |
| Molecular Formula: | C5HCl4N |
| Molecular Weight: | 216.88 |
| InChI: | InChI=1/C5HCl4N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 1.662 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.588 |
| Solubility: | 13.3 mg/L (25 C) |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | 2,3,5,6-Tetrachloropyridine is a commercially important derivative that is utilized in the manufacture of pesticides. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
