| Identification | |
| Name: | Pyridine, 3-bromo-,1-oxide |
| Synonyms: | 3-Bromopyridine1-oxide;3-Bromopyridine N-oxide;3-Bromopyridine oxide; |
| CAS: | 2402-97-3 |
| Molecular Formula: | C5H4BrNO |
| Molecular Weight: | 173.995 |
| InChI: | InChI=1S/C5H4BrNO/c6-5-2-1-3-7(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.1°C |
| Density: | 1.66g/cm3 |
| Appearance: | yellow solid |
| Specification: | Yellow Solid Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection |
| Flash Point: | 157.1°C |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
