| Identification |
| Name: | Silacyclopentane,1,1-dichloro- |
| Synonyms: | 1,1-Dichloro-1-silacyclopentane;1,1-Dichlorosilacyclopentane;Cyclotetramethylenedichlorosilane;NSC 252157; |
| CAS: | 2406-33-9 |
| EINECS: | 219-299-6 |
| Molecular Formula: | C4H8Cl2Si |
| Molecular Weight: | 155.09 |
| InChI: | InChI=1/C4H8Cl2Si/c5-7(6)3-1-2-4-7/h1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2986 |
| Density: | 1.185 |
| Refractive index: | 1.4630 |
| Water Solubility: | react with water |
| Solubility: | react with water |
| Appearance: | Clear to straw liquid with acrid odor of hydogen chloride |
| Safety Data |
| |
 |
