| Identification | |
| Name: | 2-Benzothiazolamine,5,6-dichloro- |
| Synonyms: | Benzothiazole,2-amino-5,6-dichloro- (7CI,8CI);2-Amino-5,6-dichlorobenzothiazole;5,6-Dichloro-1,3-benzothiazol-2-ylamine; |
| CAS: | 24072-75-1 |
| EINECS: | 246-006-9 |
| Molecular Formula: | C7H4Cl2N2S |
| Molecular Weight: | 219.09106 |
| InChI: | InChI=1S/C7H4Cl2N2S/c8-3-1-5-6(2-4(3)9)12-7(10)11-5/h1-2H,(H2,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | STABILITY |
| Density: | 1.654 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.761 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION
Appearance:Off-white
powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | Off-white powder |
| Specification: |
2-Benzothiazolamine,5,6-dichloro- with cas registry number of 24072-75-1 is also known as 2-Benzothiazolamine, 5,6-dichloro- ; 5,6-Dichloro-1,3-benzothiazol-2-amine ; 2-Amino-5,6-dichlorobenzothiazole ; 2-Amino-5,6-dichloro-benzothiazole ; 5,6-Dichloro-2-benzothiazolamine ; 5,6-Dichlorobenzothiazol-2-amine . It is a compound with the appearance of white solid or powder. It is insoluble in water. It should be kept in a cool, dry, dark location in a tightly sealed container or cylinder and be kept away from incompatible materials, ignition sources and untrained individuals. |
| Flash Point: | STABILITY |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols | |
 |
|
